C9H15NO3 — CID 79896090
3-(2-methyl-1,4-oxazepan-4-yl)prop-2-enoic acid (PubChem CID 79896090) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-(2-methyl-1,4-oxazepan-4-yl)prop-2-enoic acid.
| Compound Name | 3-(2-methyl-1,4-oxazepan-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 79896090 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-(2-methyl-1,4-oxazepan-4-yl)prop-2-enoic acid |
| SMILES | CC1CN(C=CC(=O)O)CCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-8-7-10(4-2-6-13-8)5-3-9(11)12/h3,5,8H,2,4,6-7H2,1H3,(H,11,12) |
| InChIKey | FBPPEWHYWLLFOS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|