C8H15F3O3S — CID 79952566
1,1,1-trifluoro-7-methylsulfonylheptan-4-ol (PubChem CID 79952566) has the molecular formula C8H15F3O3S and a molecular weight of 248.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-7-methylsulfonylheptan-4-ol.
| Compound Name | 1,1,1-trifluoro-7-methylsulfonylheptan-4-ol |
|---|---|
| PubChem CID | 79952566 |
| Molecular Formula | C8H15F3O3S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1,1,1-trifluoro-7-methylsulfonylheptan-4-ol |
| SMILES | CS(=O)(=O)CCCC(O)CCC(F)(F)F |
| InChI | InChI=1S/C8H15F3O3S/c1-15(13,14)6-2-3-7(12)4-5-8(9,10)11/h7,12H,2-6H2,1H3 |
| InChIKey | XSYYXHMIFGRHNM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |