C7H6F3N5O2 — CID 79952974
4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 79952974) has the molecular formula C7H6F3N5O2 and a molecular weight of 249.15 g/mol. Its IUPAC name is 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 79952974 |
| Molecular Formula | C7H6F3N5O2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 4-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(CCC(F)(F)F)no1 |
| InChI | InChI=1S/C7H6F3N5O2/c8-7(9,10)2-1-3-12-6(16-13-3)4-5(11)15-17-14-4/h1-2H2,(H2,11,15) |
| InChIKey | CKUIEJRKQSWJRO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |