C13H26OS2 — CID 79970852
1-(1,4-dithian-2-yl)-3-ethylheptan-1-ol (PubChem CID 79970852) has the molecular formula C13H26OS2 and a molecular weight of 262.48 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-3-ethylheptan-1-ol.
| Compound Name | 1-(1,4-dithian-2-yl)-3-ethylheptan-1-ol |
|---|---|
| PubChem CID | 79970852 |
| Molecular Formula | C13H26OS2 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-3-ethylheptan-1-ol |
| SMILES | CCCCC(CC)CC(O)C1CSCCS1 |
| InChI | InChI=1S/C13H26OS2/c1-3-5-6-11(4-2)9-12(14)13-10-15-7-8-16-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | WVNKDZQFFCUARH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |