C17H28N2 — CID 79987323
(3,5-dimethyl-1-adamantyl)-pyrrolidin-1-ylmethanimine (PubChem CID 79987323) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-pyrrolidin-1-ylmethanimine.
| Compound Name | (3,5-dimethyl-1-adamantyl)-pyrrolidin-1-ylmethanimine |
|---|---|
| PubChem CID | 79987323 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-pyrrolidin-1-ylmethanimine |
| SMILES | [H]/N=C(\N1CCCC1)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H28N2/c1-15-7-13-8-16(2,10-15)12-17(9-13,11-15)14(18)19-5-3-4-6-19/h13,18H,3-12H2,1-2H3/b18-14- |
| InChIKey | QBNIHUCXLIYKDP-JXAWBTAJSA-N |
| XLogP | 4.06 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|