C18H28N3O5S+ — CID 8018316
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 8018316) has the molecular formula C18H28N3O5S+ and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 8018316 |
| Molecular Formula | C18H28N3O5S+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CCOCC2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-25-16-6-5-15(19-18(22)14-20-9-11-26-12-10-20)13-17(16)27(23,24)21-7-3-2-4-8-21/h5-6,13H,2-4,7-12,14H2,1H3,(H,19,22)/p+1 |
| InChIKey | BSZDXJYMFKWDMH-UHFFFAOYSA-O |
| XLogP | -0.28 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |