C11H14ClN3O2S — CID 80514371
3-(2-chloroethylsulfonyl)-5,6-diethylpyridazine-4-carbonitrile (PubChem CID 80514371) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is 3-(2-chloroethylsulfonyl)-5,6-diethylpyridazine-4-carbonitrile.
| Compound Name | 3-(2-chloroethylsulfonyl)-5,6-diethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80514371 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(2-chloroethylsulfonyl)-5,6-diethylpyridazine-4-carbonitrile |
| SMILES | CCc1nnc(S(=O)(=O)CCCl)c(C#N)c1CC |
| InChI | InChI=1S/C11H14ClN3O2S/c1-3-8-9(7-13)11(15-14-10(8)4-2)18(16,17)6-5-12/h3-6H2,1-2H3 |
| InChIKey | UZNNHVJUWMDIFL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|