C13H11BrClF2NOS — CID 80530820
1-(5-bromo-4-chlorothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylmethanamine (PubChem CID 80530820) has the molecular formula C13H11BrClF2NOS and a molecular weight of 382.66 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80530820 |
| Molecular Formula | C13H11BrClF2NOS |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-[2-(difluoromethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNC(c1cc(Cl)c(Br)s1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C13H11BrClF2NOS/c1-18-11(10-6-8(15)12(14)20-10)7-4-2-3-5-9(7)19-13(16)17/h2-6,11,13,18H,1H3 |
| InChIKey | HMYCRLIBYHVVLH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |