About 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid
2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80571729) has the molecular formula C12H10Cl2N2O2S
and a molecular weight of 317.20 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 80571729 |
| Molecular Formula | C12H10Cl2N2O2S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C12H10Cl2N2O2S/c13-8-2-1-7(9(14)5-8)3-4-15-12-16-6-10(19-12)11(17)18/h1-2,5-6H,3-4H2,(H,15,16)(H,17,18) |
| InChIKey | RIGGYRJNDKFZEZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid (CID 80571729) is 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(NCCc2ccc(Cl)cc2Cl)s1.
What is the InChIKey of 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is RIGGYRJNDKFZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2O2S/c13-8-2-1-7(9(14)5-8)3-4-15-12-16-6-10(19-12)11(17)18/h1-2,5-6H,3-4H2,(H,15,16)(H,17,18).
What are the key properties of 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid?
2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 317.20 g/mol, XLogP of 3.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenyl)ethylamino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80571729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).