C16H13ClN2S — CID 80575661
6-chloro-2-(2,3-dihydro-1H-indol-3-ylmethyl)-1,3-benzothiazole (PubChem CID 80575661) has the molecular formula C16H13ClN2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 6-chloro-2-(2,3-dihydro-1H-indol-3-ylmethyl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(2,3-dihydro-1H-indol-3-ylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 80575661 |
| Molecular Formula | C16H13ClN2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 6-chloro-2-(2,3-dihydro-1H-indol-3-ylmethyl)-1,3-benzothiazole |
| SMILES | Clc1ccc2nc(CC3CNc4ccccc43)sc2c1 |
| InChI | InChI=1S/C16H13ClN2S/c17-11-5-6-14-15(8-11)20-16(19-14)7-10-9-18-13-4-2-1-3-12(10)13/h1-6,8,10,18H,7,9H2 |
| InChIKey | QYXMLMBJRZAELK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |