C10H20N4S2 — CID 80614571
5-[2-(diethylamino)ethylsulfanylmethyl]-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 80614571) has the molecular formula C10H20N4S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethylsulfanylmethyl]-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(diethylamino)ethylsulfanylmethyl]-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80614571 |
| Molecular Formula | C10H20N4S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-[2-(diethylamino)ethylsulfanylmethyl]-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCN(CC)CCSCc1nnc(NC)s1 |
| InChI | InChI=1S/C10H20N4S2/c1-4-14(5-2)6-7-15-8-9-12-13-10(11-3)16-9/h4-8H2,1-3H3,(H,11,13) |
| InChIKey | MJWVQMISSKIBFI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|