C7H15N5S2 — CID 80625805
2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine (PubChem CID 80625805) has the molecular formula C7H15N5S2 and a molecular weight of 233.37 g/mol. Its IUPAC name is 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine.
| Compound Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 80625805 |
| Molecular Formula | C7H15N5S2 |
| Molecular Weight | 233.37 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCSCc1nnc(NN)s1 |
| InChI | InChI=1S/C7H15N5S2/c1-12(2)3-4-13-5-6-10-11-7(9-8)14-6/h3-5,8H2,1-2H3,(H,9,11) |
| InChIKey | VRGYTPHKGILXGO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|