C10H13N5O4S2 — CID 80731051
N-(1-ethylpyrazol-4-yl)-5-(methylamino)-4-nitrothiophene-2-sulfonamide (PubChem CID 80731051) has the molecular formula C10H13N5O4S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-5-(methylamino)-4-nitrothiophene-2-sulfonamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80731051 |
| Molecular Formula | C10H13N5O4S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
| SMILES | CCn1cc(NS(=O)(=O)c2cc([N+](=O)[O-])c(NC)s2)cn1 |
| InChI | InChI=1S/C10H13N5O4S2/c1-3-14-6-7(5-12-14)13-21(18,19)9-4-8(15(16)17)10(11-2)20-9/h4-6,11,13H,3H2,1-2H3 |
| InChIKey | UYBYTCXASNRFQY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|