C9H16FN5O2S — CID 80818913
3-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]propane-1-sulfonamide (PubChem CID 80818913) has the molecular formula C9H16FN5O2S and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 80818913 |
| Molecular Formula | C9H16FN5O2S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]propane-1-sulfonamide |
| SMILES | CCNc1ncc(F)c(NCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H16FN5O2S/c1-2-12-9-14-6-7(10)8(15-9)13-4-3-5-18(11,16)17/h6H,2-5H2,1H3,(H2,11,16,17)(H2,12,13,14,15) |
| InChIKey | XIMSSAXFCDAEIX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|