C7H8ClN7O — CID 80900839
[4-(4-chloropyrazol-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80900839) has the molecular formula C7H8ClN7O and a molecular weight of 241.64 g/mol. Its IUPAC name is [4-(4-chloropyrazol-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-chloropyrazol-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80900839 |
| Molecular Formula | C7H8ClN7O |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | [4-(4-chloropyrazol-1-yl)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(-n2cc(Cl)cn2)n1 |
| InChI | InChI=1S/C7H8ClN7O/c1-16-7-12-5(14-9)11-6(13-7)15-3-4(8)2-10-15/h2-3H,9H2,1H3,(H,11,12,13,14) |
| InChIKey | BDYLLTKEJTYEFM-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|