C11H11NO3 — CID 81047700
(7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)methanamine (PubChem CID 81047700) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)methanamine.
| Compound Name | (7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)methanamine |
|---|---|
| PubChem CID | 81047700 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (7-methylfuro[2,3-f][1,3]benzodioxol-6-yl)methanamine |
| SMILES | Cc1c(CN)oc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C11H11NO3/c1-6-7-2-9-10(14-5-13-9)3-8(7)15-11(6)4-12/h2-3H,4-5,12H2,1H3 |
| InChIKey | YZWIXAMBPDQDOO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |