C12H22N4O4S — CID 81063691
5-ethyl-N-methyl-N-(2-propan-2-yloxyethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 81063691) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is 5-ethyl-N-methyl-N-(2-propan-2-yloxyethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-ethyl-N-methyl-N-(2-propan-2-yloxyethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 81063691 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 5-ethyl-N-methyl-N-(2-propan-2-yloxyethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)N(C)CCOC(C)C)c1S(N)(=O)=O |
| InChI | InChI=1S/C12H22N4O4S/c1-5-9-11(21(13,18)19)10(15-14-9)12(17)16(4)6-7-20-8(2)3/h8H,5-7H2,1-4H3,(H,14,15)(H2,13,18,19) |
| InChIKey | IHJZWMHYJVZBPT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |