C13H26BrNO — CID 81102837
1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylpiperidin-4-ol (PubChem CID 81102837) has the molecular formula C13H26BrNO and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 81102837 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(CC(CBr)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26BrNO/c1-12(2,3)11(9-14)10-15-7-5-13(4,16)6-8-15/h11,16H,5-10H2,1-4H3 |
| InChIKey | BZARAYRLUQIVIM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|