C15H30BrN — CID 65015031
1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-ethylazepane (PubChem CID 65015031) has the molecular formula C15H30BrN and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-ethylazepane.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-ethylazepane |
|---|---|
| PubChem CID | 65015031 |
| Molecular Formula | C15H30BrN |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-ethylazepane |
| SMILES | CCC1CCCN(CC(CBr)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30BrN/c1-5-13-7-6-9-17(10-8-13)12-14(11-16)15(2,3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | ZEAQNHMFARWUGZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|