C13H8N2OS — CID 81144115
pyridin-3-yl(thieno[3,2-b]pyridin-6-yl)methanone (PubChem CID 81144115) has the molecular formula C13H8N2OS and a molecular weight of 240.29 g/mol. Its IUPAC name is pyridin-3-yl(thieno[3,2-b]pyridin-6-yl)methanone.
| Compound Name | pyridin-3-yl(thieno[3,2-b]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 81144115 |
| Molecular Formula | C13H8N2OS |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | pyridin-3-yl(thieno[3,2-b]pyridin-6-yl)methanone |
| SMILES | O=C(c1cccnc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H8N2OS/c16-13(9-2-1-4-14-7-9)10-6-12-11(15-8-10)3-5-17-12/h1-8H |
| InChIKey | KBUSVIPNTWIWHD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |