C14H7F2NOS — CID 81148270
(2,3-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanone (PubChem CID 81148270) has the molecular formula C14H7F2NOS and a molecular weight of 275.28 g/mol. Its IUPAC name is (2,3-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanone.
| Compound Name | (2,3-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanone |
|---|---|
| PubChem CID | 81148270 |
| Molecular Formula | C14H7F2NOS |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (2,3-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanone |
| SMILES | O=C(c1cnc2ccsc2c1)c1cccc(F)c1F |
| InChI | InChI=1S/C14H7F2NOS/c15-10-3-1-2-9(13(10)16)14(18)8-6-12-11(17-7-8)4-5-19-12/h1-7H |
| InChIKey | UVBNHXJMBRZJMS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |