C12H16O2S — CID 81156363
(3,5-dimethylthiophen-2-yl)-(oxan-4-yl)methanone (PubChem CID 81156363) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is (3,5-dimethylthiophen-2-yl)-(oxan-4-yl)methanone.
| Compound Name | (3,5-dimethylthiophen-2-yl)-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 81156363 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (3,5-dimethylthiophen-2-yl)-(oxan-4-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)C2CCOCC2)s1 |
| InChI | InChI=1S/C12H16O2S/c1-8-7-9(2)15-12(8)11(13)10-3-5-14-6-4-10/h7,10H,3-6H2,1-2H3 |
| InChIKey | ZOANDOBMJWAHEH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |