C16H16ClNO — CID 81234042
3-(chloromethyl)-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine (PubChem CID 81234042) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine.
| Compound Name | 3-(chloromethyl)-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine |
|---|---|
| PubChem CID | 81234042 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-(chloromethyl)-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine |
| SMILES | ClCc1cnccc1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H16ClNO/c17-10-13-11-18-9-8-15(13)19-16-7-3-5-12-4-1-2-6-14(12)16/h1-2,4,6,8-9,11,16H,3,5,7,10H2 |
| InChIKey | OIJOBCRLFUIBBI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|