C15H18F2N2O2 — CID 81285260
6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid (PubChem CID 81285260) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid.
| Compound Name | 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 81285260 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid |
| SMILES | CCC(CCNc1c(F)cc(C#N)cc1F)CCC(=O)O |
| InChI | InChI=1S/C15H18F2N2O2/c1-2-10(3-4-14(20)21)5-6-19-15-12(16)7-11(9-18)8-13(15)17/h7-8,10,19H,2-6H2,1H3,(H,20,21) |
| InChIKey | YHHNZRCDAWPFRZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |