6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid

C15H18F2N2O2 — CID 81285260

IUPAC6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid
SMILESCCC(CCNc1c(F)cc(C#N)cc1F)CCC(=O)O
InChIInChI=1S/C15H18F2N2O2/c1-2-10(3-4-14(20)21)5-6-19-15-12(16)7-11(9-18)8-13(15)17/h7-8,10,19H,2-6H2,1H3,(H,20,21)
InChIKeyYHHNZRCDAWPFRZ-UHFFFAOYSA-N
MW296.32 g/mol
LogP3.53
Rot. Bonds8

About 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid

6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid (PubChem CID 81285260) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid.

Molecular Properties

Compound Name6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid
PubChem CID81285260
Molecular FormulaC15H18F2N2O2
Molecular Weight296.32 g/mol
Exact Mass296.13
IUPAC Name6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid
SMILESCCC(CCNc1c(F)cc(C#N)cc1F)CCC(=O)O
InChIInChI=1S/C15H18F2N2O2/c1-2-10(3-4-14(20)21)5-6-19-15-12(16)7-11(9-18)8-13(15)17/h7-8,10,19H,2-6H2,1H3,(H,20,21)
InChIKeyYHHNZRCDAWPFRZ-UHFFFAOYSA-N
XLogP3.53
TPSA73.12 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.32
LogP ≤ 53.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid?
The IUPAC name of 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid (CID 81285260) is 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid.
What is the SMILES notation for 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid?
The canonical SMILES for 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid is CCC(CCNc1c(F)cc(C#N)cc1F)CCC(=O)O.
What is the InChIKey of 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid?
The InChIKey is YHHNZRCDAWPFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2O2/c1-2-10(3-4-14(20)21)5-6-19-15-12(16)7-11(9-18)8-13(15)17/h7-8,10,19H,2-6H2,1H3,(H,20,21).
What are the key properties of 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid?
6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid has a molecular weight of 296.32 g/mol, XLogP of 3.53, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-cyano-2,6-difluoroanilino)-4-ethylhexanoic acid is sourced from PubChem (CID 81285260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).