About 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane
1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane (PubChem CID 82018244) has the molecular formula C4H4F6O2S
and a molecular weight of 230.13 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane.
Analyze 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane?
The IUPAC name of 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane (CID 82018244) is 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane.
What is the SMILES notation for 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane?
The canonical SMILES for 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane is O=S(=O)(CC(F)(F)F)CC(F)(F)F.
What is the InChIKey of 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane?
The InChIKey is HGQHVEDIXCKVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F6O2S/c5-3(6,7)1-13(11,12)2-4(8,9)10/h1-2H2.
What are the key properties of 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane?
1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane has a molecular weight of 230.13 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoro-2-(2,2,2-trifluoroethylsulfonyl)ethane is sourced from PubChem (CID 82018244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).