C5H3F9O2S — CID 13358485
1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethylsulfonyl)propane (PubChem CID 13358485) has the molecular formula C5H3F9O2S and a molecular weight of 298.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethylsulfonyl)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethylsulfonyl)propane |
|---|---|
| PubChem CID | 13358485 |
| Molecular Formula | C5H3F9O2S |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethylsulfonyl)propane |
| SMILES | O=S(=O)(CC(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O2S/c6-3(7,8)1-17(15,16)2(4(9,10)11)5(12,13)14/h2H,1H2 |
| InChIKey | RFVLDIPJXHACQB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |