C4H3F6O3S- — CID 23533131
1,1,1,4,4,4-hexafluorobutane-2-sulfonate (PubChem CID 23533131) has the molecular formula C4H3F6O3S- and a molecular weight of 245.12 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2-sulfonate.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2-sulfonate |
|---|---|
| PubChem CID | 23533131 |
| Molecular Formula | C4H3F6O3S- |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O3S/c5-3(6,7)1-2(4(8,9)10)14(11,12)13/h2H,1H2,(H,11,12,13)/p-1 |
| InChIKey | FDRGXCRXZWYXCX-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|