C12H13NO3 — CID 82045994
spiro[chromene-2,3'-pyrrolidine]-7,8-diol (PubChem CID 82045994) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is spiro[chromene-2,3'-pyrrolidine]-7,8-diol.
| Compound Name | spiro[chromene-2,3'-pyrrolidine]-7,8-diol |
|---|---|
| PubChem CID | 82045994 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | spiro[chromene-2,3'-pyrrolidine]-7,8-diol |
| SMILES | Oc1ccc2c(c1O)OC1(C=C2)CCNC1 |
| InChI | InChI=1S/C12H13NO3/c14-9-2-1-8-3-4-12(5-6-13-7-12)16-11(8)10(9)15/h1-4,13-15H,5-7H2 |
| InChIKey | WSJRVNLCKPVJPH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|