C13H17ClN4O3S — CID 82065587
2-methoxyethyl 4-(2-aminoethylamino)-2-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 82065587) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 2-methoxyethyl 4-(2-aminoethylamino)-2-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 4-(2-aminoethylamino)-2-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 82065587 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-methoxyethyl 4-(2-aminoethylamino)-2-chloro-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2nc(Cl)nc(NCCN)c2c1C |
| InChI | InChI=1S/C13H17ClN4O3S/c1-7-8-10(16-4-3-15)17-13(14)18-11(8)22-9(7)12(19)21-6-5-20-2/h3-6,15H2,1-2H3,(H,16,17,18) |
| InChIKey | WVZHGZLLNGYNNP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|