C19H29NO3 — CID 82073670
3-[bis(prop-2-enyl)amino]-1-(3,4-diethoxyphenyl)propan-1-ol (PubChem CID 82073670) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)amino]-1-(3,4-diethoxyphenyl)propan-1-ol.
| Compound Name | 3-[bis(prop-2-enyl)amino]-1-(3,4-diethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82073670 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-[bis(prop-2-enyl)amino]-1-(3,4-diethoxyphenyl)propan-1-ol |
| SMILES | C=CCN(CC=C)CCC(O)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C19H29NO3/c1-5-12-20(13-6-2)14-11-17(21)16-9-10-18(22-7-3)19(15-16)23-8-4/h5-6,9-10,15,17,21H,1-2,7-8,11-14H2,3-4H3 |
| InChIKey | AWAHBVYZZXDZDM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|