C11H11NOS — CID 82077516
2-(2,4-dimethylphenyl)-1,2-thiazol-3-one (PubChem CID 82077516) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1,2-thiazol-3-one.
| Compound Name | 2-(2,4-dimethylphenyl)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 82077516 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1,2-thiazol-3-one |
| SMILES | Cc1ccc(-n2sccc2=O)c(C)c1 |
| InChI | InChI=1S/C11H11NOS/c1-8-3-4-10(9(2)7-8)12-11(13)5-6-14-12/h3-7H,1-2H3 |
| InChIKey | AINVLQXKTKVVLS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |