C15H25NO2 — CID 82111076
2-[(2,5-dimethoxyphenyl)methyl]-2-ethylbutan-1-amine (PubChem CID 82111076) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methyl]-2-ethylbutan-1-amine.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methyl]-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 82111076 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methyl]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)(CN)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H25NO2/c1-5-15(6-2,11-16)10-12-9-13(17-3)7-8-14(12)18-4/h7-9H,5-6,10-11,16H2,1-4H3 |
| InChIKey | KKZCWPBWIUOZEH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |