C16H23NO2 — CID 82121773
N-butan-2-yl-2-oxo-2-(2,3,5,6-tetramethylphenyl)acetamide (PubChem CID 82121773) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-butan-2-yl-2-oxo-2-(2,3,5,6-tetramethylphenyl)acetamide.
| Compound Name | N-butan-2-yl-2-oxo-2-(2,3,5,6-tetramethylphenyl)acetamide |
|---|---|
| PubChem CID | 82121773 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-butan-2-yl-2-oxo-2-(2,3,5,6-tetramethylphenyl)acetamide |
| SMILES | CCC(C)NC(=O)C(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C16H23NO2/c1-7-11(4)17-16(19)15(18)14-12(5)9(2)8-10(3)13(14)6/h8,11H,7H2,1-6H3,(H,17,19) |
| InChIKey | BFTMLCDBTJIKSL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|