C18H23N3O3 — CID 82148240
3-[4-ethyl-2,5-dioxo-4-(4-propoxyphenyl)imidazolidin-1-yl]-2-methylpropanenitrile (PubChem CID 82148240) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[4-ethyl-2,5-dioxo-4-(4-propoxyphenyl)imidazolidin-1-yl]-2-methylpropanenitrile.
| Compound Name | 3-[4-ethyl-2,5-dioxo-4-(4-propoxyphenyl)imidazolidin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 82148240 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[4-ethyl-2,5-dioxo-4-(4-propoxyphenyl)imidazolidin-1-yl]-2-methylpropanenitrile |
| SMILES | CCCOc1ccc(C2(CC)NC(=O)N(CC(C)C#N)C2=O)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-4-10-24-15-8-6-14(7-9-15)18(5-2)16(22)21(17(23)20-18)12-13(3)11-19/h6-9,13H,4-5,10,12H2,1-3H3,(H,20,23) |
| InChIKey | LKOQZISLWKYTTL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|