C19H24N2 — CID 82156683
4-benzyl-3,3,6,7-tetramethyl-1,2-dihydroquinoxaline (PubChem CID 82156683) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-benzyl-3,3,6,7-tetramethyl-1,2-dihydroquinoxaline.
| Compound Name | 4-benzyl-3,3,6,7-tetramethyl-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 82156683 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-benzyl-3,3,6,7-tetramethyl-1,2-dihydroquinoxaline |
| SMILES | Cc1cc2c(cc1C)N(Cc1ccccc1)C(C)(C)CN2 |
| InChI | InChI=1S/C19H24N2/c1-14-10-17-18(11-15(14)2)21(19(3,4)13-20-17)12-16-8-6-5-7-9-16/h5-11,20H,12-13H2,1-4H3 |
| InChIKey | FQXRBZBVCDUMMS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |