About 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole
3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole (PubChem CID 70429090) has the molecular formula C12H14Br2N2
and a molecular weight of 346.07 g/mol. Its IUPAC name is 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole.
Molecular Properties
| Compound Name | 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole |
| PubChem CID | 70429090 |
| Molecular Formula | C12H14Br2N2 |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole |
| SMILES | CC1=C(Br)N(Cc2ccccc2)C(C)(Br)N1 |
| InChI | InChI=1S/C12H14Br2N2/c1-9-11(13)16(12(2,14)15-9)8-10-6-4-3-5-7-10/h3-7,15H,8H2,1-2H3 |
| InChIKey | KJXYFJHGOTYKOI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole?
The IUPAC name of 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole (CID 70429090) is 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole.
What is the SMILES notation for 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole?
The canonical SMILES for 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole is CC1=C(Br)N(Cc2ccccc2)C(C)(Br)N1.
What is the InChIKey of 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole?
The InChIKey is KJXYFJHGOTYKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2N2/c1-9-11(13)16(12(2,14)15-9)8-10-6-4-3-5-7-10/h3-7,15H,8H2,1-2H3.
What are the key properties of 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole?
3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole has a molecular weight of 346.07 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2,4-dibromo-2,5-dimethyl-1H-imidazole is sourced from PubChem (CID 70429090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).