C13H8N2O2 — CID 82158868
2-pyridin-3-yl-1,3-benzoxazole-5-carbaldehyde (PubChem CID 82158868) has the molecular formula C13H8N2O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,3-benzoxazole-5-carbaldehyde.
| Compound Name | 2-pyridin-3-yl-1,3-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82158868 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-pyridin-3-yl-1,3-benzoxazole-5-carbaldehyde |
| SMILES | O=Cc1ccc2oc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C13H8N2O2/c16-8-9-3-4-12-11(6-9)15-13(17-12)10-2-1-5-14-7-10/h1-8H |
| InChIKey | KRBJUBKJOXGRRI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|