C11H10ClNO2S2 — CID 82161769
5-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-methyl-3H-1,3-thiazole-2-thione (PubChem CID 82161769) has the molecular formula C11H10ClNO2S2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 5-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-methyl-3H-1,3-thiazole-2-thione.
| Compound Name | 5-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-methyl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 82161769 |
| Molecular Formula | C11H10ClNO2S2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 5-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-methyl-3H-1,3-thiazole-2-thione |
| SMILES | COc1cc(-c2sc(=S)[nH]c2C)cc(Cl)c1O |
| InChI | InChI=1S/C11H10ClNO2S2/c1-5-10(17-11(16)13-5)6-3-7(12)9(14)8(4-6)15-2/h3-4,14H,1-2H3,(H,13,16) |
| InChIKey | BKNSSERRPUZVNZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|