C18H21NO3 — CID 82188689
4-[benzyl(methyl)amino]-8-methoxy-3,4-dihydro-2H-chromen-3-ol (PubChem CID 82188689) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[benzyl(methyl)amino]-8-methoxy-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | 4-[benzyl(methyl)amino]-8-methoxy-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 82188689 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[benzyl(methyl)amino]-8-methoxy-3,4-dihydro-2H-chromen-3-ol |
| SMILES | COc1cccc2c1OCC(O)C2N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-19(11-13-7-4-3-5-8-13)17-14-9-6-10-16(21-2)18(14)22-12-15(17)20/h3-10,15,17,20H,11-12H2,1-2H3 |
| InChIKey | VFDAUTKLRVICSA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |