C18H20FNO2 — CID 82188579
4-[benzyl(ethyl)amino]-6-fluoro-3,4-dihydro-2H-chromen-3-ol (PubChem CID 82188579) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-[benzyl(ethyl)amino]-6-fluoro-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | 4-[benzyl(ethyl)amino]-6-fluoro-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 82188579 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[benzyl(ethyl)amino]-6-fluoro-3,4-dihydro-2H-chromen-3-ol |
| SMILES | CCN(Cc1ccccc1)C1c2cc(F)ccc2OCC1O |
| InChI | InChI=1S/C18H20FNO2/c1-2-20(11-13-6-4-3-5-7-13)18-15-10-14(19)8-9-17(15)22-12-16(18)21/h3-10,16,18,21H,2,11-12H2,1H3 |
| InChIKey | UATMYHGMSKACMU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |