C12H11N3O2S — CID 82194063
(E)-N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 82194063) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is (E)-N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 82194063 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (E)-N-(5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1nc2c(s1)CNC2 |
| InChI | InChI=1S/C12H11N3O2S/c16-11(4-3-8-2-1-5-17-8)15-12-14-9-6-13-7-10(9)18-12/h1-5,13H,6-7H2,(H,14,15,16)/b4-3+ |
| InChIKey | ZFBPUMQXDTWOPP-ONEGZZNKSA-N |
| XLogP | 1.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|