C12H11N5S — CID 82221182
3-[3-(4-methyl-1,3-thiazol-2-yl)triazol-4-yl]aniline (PubChem CID 82221182) has the molecular formula C12H11N5S and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-[3-(4-methyl-1,3-thiazol-2-yl)triazol-4-yl]aniline.
| Compound Name | 3-[3-(4-methyl-1,3-thiazol-2-yl)triazol-4-yl]aniline |
|---|---|
| PubChem CID | 82221182 |
| Molecular Formula | C12H11N5S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-[3-(4-methyl-1,3-thiazol-2-yl)triazol-4-yl]aniline |
| SMILES | Cc1csc(-n2nncc2-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C12H11N5S/c1-8-7-18-12(15-8)17-11(6-14-16-17)9-3-2-4-10(13)5-9/h2-7H,13H2,1H3 |
| InChIKey | MKAUFWXLSWJYQR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|