C16H14N4O2 — CID 82222193
3-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-1-yl]aniline (PubChem CID 82222193) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-1-yl]aniline.
| Compound Name | 3-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-1-yl]aniline |
|---|---|
| PubChem CID | 82222193 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-1-yl]aniline |
| SMILES | Nc1cccc(-n2nncc2-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C16H14N4O2/c17-12-2-1-3-13(9-12)20-14(10-18-19-20)11-4-5-15-16(8-11)22-7-6-21-15/h1-5,8-10H,6-7,17H2 |
| InChIKey | UGKTXEMFUJBAQL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|