C11H10N4O2S — CID 82222421
2-[5-(1,3-benzodioxol-5-yl)triazol-1-yl]ethanethioamide (PubChem CID 82222421) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-yl)triazol-1-yl]ethanethioamide.
| Compound Name | 2-[5-(1,3-benzodioxol-5-yl)triazol-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 82222421 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-yl)triazol-1-yl]ethanethioamide |
| SMILES | NC(=S)Cn1nncc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H10N4O2S/c12-11(18)5-15-8(4-13-14-15)7-1-2-9-10(3-7)17-6-16-9/h1-4H,5-6H2,(H2,12,18) |
| InChIKey | BJZWKCUILOTHQM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|