C10H14N2O5S — CID 82225305
3-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methyl-2-oxo-1,3-thiazole-5-carboxylic acid (PubChem CID 82225305) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 3-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methyl-2-oxo-1,3-thiazole-5-carboxylic acid.
| Compound Name | 3-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methyl-2-oxo-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82225305 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methyl-2-oxo-1,3-thiazole-5-carboxylic acid |
| SMILES | COCCNC(=O)Cn1c(C)c(C(=O)O)sc1=O |
| InChI | InChI=1S/C10H14N2O5S/c1-6-8(9(14)15)18-10(16)12(6)5-7(13)11-3-4-17-2/h3-5H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | DTEVSTUZRMEOAY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|