C13H19NO — CID 82230354
6-ethyl-3-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82230354) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 6-ethyl-3-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-ethyl-3-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82230354 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 6-ethyl-3-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCc1ccc2c(c1)NC(C(C)C)CO2 |
| InChI | InChI=1S/C13H19NO/c1-4-10-5-6-13-11(7-10)14-12(8-15-13)9(2)3/h5-7,9,12,14H,4,8H2,1-3H3 |
| InChIKey | VBGSUSHWXCNKDS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |