C9H5ClF3NO — CID 82231721
5-chloro-2-methyl-7-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 82231721) has the molecular formula C9H5ClF3NO and a molecular weight of 235.59 g/mol. Its IUPAC name is 5-chloro-2-methyl-7-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-methyl-7-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 82231721 |
| Molecular Formula | C9H5ClF3NO |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 5-chloro-2-methyl-7-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | Cc1nc2cc(Cl)cc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C9H5ClF3NO/c1-4-14-7-3-5(10)2-6(8(7)15-4)9(11,12)13/h2-3H,1H3 |
| InChIKey | ZVEAAIPHWAUMAJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |