C14H18ClNO — CID 176945226
5-chloro-2-methyl-6,7-di(propan-2-yl)-1,3-benzoxazole (PubChem CID 176945226) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 5-chloro-2-methyl-6,7-di(propan-2-yl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-methyl-6,7-di(propan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 176945226 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-chloro-2-methyl-6,7-di(propan-2-yl)-1,3-benzoxazole |
| SMILES | Cc1nc2cc(Cl)c(C(C)C)c(C(C)C)c2o1 |
| InChI | InChI=1S/C14H18ClNO/c1-7(2)12-10(15)6-11-14(13(12)8(3)4)17-9(5)16-11/h6-8H,1-5H3 |
| InChIKey | FPCFQZZQHBMMER-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |