C10H9ClN2O2 — CID 82287443
5-(2-chloro-4-methoxyphenyl)-1,3-oxazol-2-amine (PubChem CID 82287443) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 5-(2-chloro-4-methoxyphenyl)-1,3-oxazol-2-amine.
| Compound Name | 5-(2-chloro-4-methoxyphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 82287443 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-(2-chloro-4-methoxyphenyl)-1,3-oxazol-2-amine |
| SMILES | COc1ccc(-c2cnc(N)o2)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-14-6-2-3-7(8(11)4-6)9-5-13-10(12)15-9/h2-5H,1H3,(H2,12,13) |
| InChIKey | FEKYSLXPXXPURZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |