C13H19NO6 — CID 82324412
3-[furan-2-carbonyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylpropanoic acid (PubChem CID 82324412) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[furan-2-carbonyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[furan-2-carbonyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82324412 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-[furan-2-carbonyl-[2-(2-hydroxyethoxy)ethyl]amino]-2-methylpropanoic acid |
| SMILES | CC(CN(CCOCCO)C(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C13H19NO6/c1-10(13(17)18)9-14(4-7-19-8-5-15)12(16)11-3-2-6-20-11/h2-3,6,10,15H,4-5,7-9H2,1H3,(H,17,18) |
| InChIKey | JNWSUOPNBPMFBU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|